3-Oxo-5β-cholanoic acid
Cat. No. :YN371030
CAS No. :1553-56-6
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | 3-Oxo-5β-cholanoic acid |
| CAS NO.: | 1553-56-6 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 374.56 |
| Molecular Formula: | C₂₄H₃₈O₃ |
| SMILES: | C[C@H](CCC(O)=O)[C@H]1CC[C@@]2([H])[C@]3([H])CC[C@]4([H])CC(CC[C@]4(C)[C@@]3([H])CC[C@]12C)=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | 3-Oxo-5β-cholanoic acid (Dehydrolithocholic acid), a bile acid metabolite, inhibits the diferentiation ofTH17cells by directly binding to the key transcription factorRORγt(Kd=1.13μM). |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
