3-Bromo-7-nitroindazole
Cat. No. :YN330031
CAS No. :74209-34-0
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | 3-Bromo-7-nitroindazole |
| CAS NO.: | 74209-34-0 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 242.03 |
| Molecular Formula: | C₇H₄BrN₃O₂ |
| SMILES: | O=[N+](C1=CC=CC2=C1NN=C2Br)[O-] |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | 3-Bromo-7-nitroindazole is a more potent and selective inhibitor ofneuronal nitric oxide synthase (nNOS)than eNOS or inducible nitric oxide synthase (iNOS). 3-Bromo-7-nitroindazole affects the intercellular messenger nitric oxide (NO) synthesis throughout the body and brain. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
