Liothyronine
Cat. No. :YN372710
CAS No. :6893-02-3
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Liothyronine |
| CAS NO.: | 6893-02-3 |
| Chemical Name: | |
| Synonyms: | T3 |
| Molecular Weight: | 650.97 |
| Molecular Formula: | C₁₅H₁₂I₃NO₄ |
| SMILES: | OC1=C(I)C=C(OC2=C(I)C=C(C[C@H](N)C(O)=O)C=C2I)C=C1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Triiodothyronine is a thyroid hormone that affects various physiological process in the body, including growth and development, metabolism, body temperature, and heart rate. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
