Liothyronine sodium
Cat. No. :YN481751
CAS No. :55-06-1
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Liothyronine sodium |
| CAS NO.: | 55-06-1 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 672.96 |
| Molecular Formula: | C₁₅H₁₁I₃NNaO₄ |
| SMILES: | N[C@@H](CC1=CC(I)=C(C(I)=C1)OC2=CC=C(O)C(I)=C2)C(O[Na])=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Liothyronine Sodium is the most potent form of thyroid hormone acting on the body to increase the basal metabolic rate, affect protein synthesis. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
