BQ-788 sodium salt
Cat. No. :YN321046
CAS No. :156161-89-6
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | BQ-788 sodium salt |
| CAS NO.: | 156161-89-6 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 663.78 |
| Molecular Formula: | C₃₄H₅₀N₅NaO₇ |
| SMILES: | CCCC[C@H](C(O[Na])=O)NC([C@@H](CC1=CN(C(OC)=O)C2=CC=CC=C12)NC([C@H](CC(C)(C)C)NC(N3[C@H](C)CCC[C@@H]3C)=O)=O)=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | BQ-788 sodium salt is a potent and selectiveETB receptorantagonist, inhibiting ET-1 binding to ETB receptors with an IC50 of 1.2nM in human Girrardi heart cells. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
