Sobetirome
Cat. No. :YN481402
CAS No. :211110-63-3
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Sobetirome |
| CAS NO.: | 211110-63-3 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 328.40 |
| Molecular Formula: | C₂₀H₂₄O₄ |
| SMILES: | O=C(O)COC1=CC(C)=C(CC2=CC=C(O)C(C(C)C)=C2)C(C)=C1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Sobetirome (GC-1) is a thyroid hormone receptor β (TRβ)-specific agonist which bind selectively toTRβ-1with an EC50 of 0.16μM. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
