Cabergoline
Cat. No. :YN280080
CAS No. :81409-90-7
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Cabergoline |
| CAS NO.: | 81409-90-7 |
| Chemical Name: | |
| Synonyms: | FCE-21336 |
| Molecular Weight: | 451.60 |
| Molecular Formula: | C₂₆H₃₇N₅O₂ |
| SMILES: | C=CCN1[C@](C2C[C@@H](C(N(CCCN(C)C)C(NCC)=O)=O)C1)([H])CC3=CNC4=CC=CC2=C43 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Cabergoline, an ergot derivative, is a long-acting dopamine agonist and prolactin inhibitor. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
