Atipamezole
Cat. No. :YN320585
CAS No. :104054-27-5
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Atipamezole |
| CAS NO.: | 104054-27-5 |
| Chemical Name: | |
| Synonyms: | MPV-1248, MPV1248, MPV 1248, Antisedan |
| Molecular Weight: | 212.29 |
| Molecular Formula: | C₁₄H₁₆N₂ |
| SMILES: | CCC1(C2=CN=CN2)CC3=C(C=CC=C3)C1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Atipamezole is a synthetic α2 adrenergic receptor antagonist. It has also been researched in humans as a potential anti-Parkinsonian drug. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
