Atosiban acetate
Cat. No. :YN321162
CAS No. :914453-95-5
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Atosiban acetate |
| CAS NO.: | 914453-95-5 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 1054.24 |
| Molecular Formula: | C₄₅H₇₁N₁₁O₁₄S₂ |
| SMILES: | O=C([C@H](CSSCCC(N[C@@H](C1=O)CC2=CC=C(OCC)C=C2)=O)NC([C@@H](NC(C(NC([C@](N1)([H])[C@@H](C)CC)=O)[C@H](O)C)=O)CC(N)=O)=O)N(CCC3)[C@@H]3C(N[C@@H](CCCN)C(NCC(N)=O)=O)=O.OC(C)=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Atosiban acetate (RW22164 acetate;RWJ22164 acetate) is a nonapeptide competitivevasopressin/oxytocin receptorantagonist, and is a desamino-oxytocin analogue. Atosiban is the main tocolytic agent and has the potential for spontaneous preterm labor research. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
