Norethisterone enanthate
Cat. No. :YN481767
CAS No. :3836-23-5
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Norethisterone enanthate |
| CAS NO.: | 3836-23-5 |
| Chemical Name: | |
| Synonyms: | norethindrone enanthate |
| Molecular Weight: | 410.59 |
| Molecular Formula: | C₂₇H₃₈O₃ |
| SMILES: | C#C[C@]1(OC(CCCCCC)=O)CC[C@@]2([H])[C@]3([H])CCC4=CC(CC[C@]4([H])[C@@]3([H])CC[C@]12C)=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Norethisterone Enanthate is a form of progestogen-only injectable birth control which is used to prevent pregnancy in women. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
