Carboprost tromethamine
Cat. No. :YN321360
CAS No. :58551-69-2
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Carboprost tromethamine |
| CAS NO.: | 58551-69-2 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 489.64 |
| Molecular Formula: | C₂₅H₄₇NO₈ |
| SMILES: | CCCCC[C@](C)(O)/C=C/[C@@H]1[C@H]([C@@H](O)C[C@H]1O)C/C=CCCCC(O)=O.OCC(CO)(N)CO |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Carboprost tromethamine is the synthetic 15-methyl analogue of prostagl and in F2α. Carboprost tromethamine can effectively promote law contraction of the uterus and significantly reduce the amount of bleeding during and after delivery. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
