RU 58841
Cat. No. :YN480279
CAS No. :154992-24-2
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | RU 58841 |
| CAS NO.: | 154992-24-2 |
| Chemical Name: | |
| Synonyms: | PSK3841, HMR3841 |
| Molecular Weight: | 369.34 |
| Molecular Formula: | C₁₇H₁₈F₃N₃O₃ |
| SMILES: | FC(F)(C1=C(C=CC(N2C(C(C)(N(C2=O)CCCCO)C)=O)=C1)C#N)F |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | RU58841, also known as PSK-3841 or HMR-3841, is a non-steroidal anti-androgen. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
