Norethindrone
Cat. No. :YN481830
CAS No. :68-22-4
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Norethindrone |
| CAS NO.: | 68-22-4 |
| Chemical Name: | |
| Synonyms: | Norethisterone |
| Molecular Weight: | 298.42 |
| Molecular Formula: | C₂₀H₂₆O₂ |
| SMILES: | C[C@@]1([C@]2(O)C#C)[C@](CC2)([H])[C@@](CCC3=CC4=O)([H])[C@]([C@@]3([H])CC4)([H])CC1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Norethindrone is a synthetic progestin, which mimic the actions of the endogenous ovarian hormone progesterone. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
