Narlaprevir
Cat. No. :YN370254
CAS No. :865466-24-6
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Narlaprevir |
| CAS NO.: | 865466-24-6 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 707.96 |
| Molecular Formula: | C₃₆H₆₁N₅O₇S |
| SMILES: | O=S(CC1(NC(N[C@H](C(N2[C@@H]([C@@]3([H])C(C)([C@]3(C2)[H])C)C(N[C@H](C(C(NC4CC4)=O)=O)CCCC)=O)=O)C(C)(C)C)=O)CCCCC1)(C(C)(C)C)=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Narlaprevir is a potent, selective, orally bioavailable NS3 protease inhibitor(Ki=6nM; EC90=40nM) |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
