Methoprene
Cat. No. :YN251246
CAS No. :40596-69-8
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Methoprene |
| CAS NO.: | 40596-69-8 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 310.47 |
| Molecular Formula: | C₁₉H₃₄O₃ |
| SMILES: | CC(C)(OC)CCCC(C)C/C=C/C(C)=C/C(OC(C)C)=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Methoprene is a juvenile hormone (JH) analog, does not kill insects, acts as an insect growth regulator, interferes with an insect's lifecycle and prevents it from reaching maturity or reproducing, is a biological pesticide. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
