Naphthoquine phosphate
Cat. No. :YN250699
CAS No. :173531-58-3
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Naphthoquine phosphate |
| CAS NO.: | 173531-58-3 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 605.94 |
| Molecular Formula: | C₂₄H₃₄ClN₃O₉P₂ |
| SMILES: | ClC1=CC=C(C(NC2=C(CCCC3)C3=C(O)C(CNC(C)(C)C)=C2)=CC=N4)C4=C1.O=P(O)(O)O.O=P(O)(O)O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Naphthoquine phosphate is a potent and orally active antimalarial agent. Naphthoquine phosphate has thorough killing function for various schizonts ofplasmodia, including resistance ofP. falciparumto Chloroquine. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
