Pyrimethamine
Cat. No. :YN250778
CAS No. :58-14-0
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Pyrimethamine |
| CAS NO.: | 58-14-0 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 248.71 |
| Molecular Formula: | C₁₂H₁₃ClN₄ |
| SMILES: | NC1=NC(N)=C(C2=CC=C(Cl)C=C2)C(CC)=N1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Pyrimethamine is a dihydrofolate reductase (DHFR) inhibitor, used as an antimalarial drug. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
