Telbivudine
Cat. No. :YN250896
CAS No. :3424-98-4
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Telbivudine |
| CAS NO.: | 3424-98-4 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 242.23 |
| Molecular Formula: | C₁₀H₁₄N₂O₅ |
| SMILES: | CC1=CN([C@@H]2C[C@@H](O)[C@H](CO)O2)C(NC1=O)=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Telbivudine is a potent, and selective HBV reverse transcriptase inhibitor, used to treat HBV infection. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
