Oxiconazole nitrate
Cat. No. :YN251293
CAS No. :64211-46-7
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Oxiconazole nitrate |
| CAS NO.: | 64211-46-7 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 492.14 |
| Molecular Formula: | C₁₈H₁₄Cl₄N₄O₄ |
| SMILES: | [O-][N+](O)=O.ClC1=CC=C(/C(CN2C=CN=C2)=N/OCC3=CC=C(Cl)C=C3Cl)C(Cl)=C1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Oxiconazole nitrate is a broad spectrum antifungal which can inhibit the growth ofT. tonsurans and T. rubrumwithMIC90s of 0.25 and 0.5 μg/mL, respectively. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
