Inarigivir
Cat. No. :YN250079
CAS No. :475650-36-3
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Inarigivir |
| CAS NO.: | 475650-36-3 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 587.50 |
| Molecular Formula: | C₂₀H₂₆N₇O₁₀PS |
| SMILES: | NC1=C(N=CN2[C@@H]3O[C@H](COP(O[C@H]4[C@@H](OC)[C@H](N5C=CC(NC5=O)=O)O[C@@H]4CO)(S)=O)[C@@H](O)C3)C2=NC=N1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Inarigivir (ORI-9020;SB-9000) is a dinucleotide which can significantly reduce liverHBVDNA in transgenic mice expressing hepatitis B virus. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
