Tenofovir hydrate
Cat. No. :YN250574
CAS No. :206184-49-8
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Tenofovir hydrate |
| CAS NO.: | 206184-49-8 |
| Chemical Name: | |
| Synonyms: | GS-1278 hydrate |
| Molecular Weight: | 305.23 |
| Molecular Formula: | C₉H₁₆N₅O₅P |
| SMILES: | C[C@@H](OCP(O)(O)=O)CN1C=NC2=C(N)N=CN=C12.O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Tenofovir (GS-1278) hydrate blocks reverse transcriptase and hepatitis B virus infections. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
