Carbosulfan
Cat. No. :YN372958
CAS No. :55285-14-8
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Carbosulfan |
| CAS NO.: | 55285-14-8 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 380.54 |
| Molecular Formula: | C₂₀H₃₂N₂O₃S |
| SMILES: | O=C(OC1=C(OC(C)(C)C2)C2=CC=C1)N(SN(CCCC)CCCC)C |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Carbosulfan inhibited relatively potently CYP3A4 and moderately CYP1A1/2 and CYP2C19 in pooled HLM (human livers). Carbosulfan activation is predominantly catalyzed in humans by CYP3A4. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
