Foscarnet sodium
Cat. No. :YN251289
CAS No. :63585-09-1
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Foscarnet sodium |
| CAS NO.: | 63585-09-1 |
| Chemical Name: | |
| Synonyms: | Phosphonoformate |
| Molecular Weight: | 191.95 |
| Molecular Formula: | CNa₃O₅P |
| SMILES: | O=P(O[Na])(O[Na])C(O[Na])=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Foscarnet Sodium inhibits viral RNA polymerases, reverse transcriptase, and DNA polymerases through noncompetitive inhibition with dNTPs. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
