α-L-Rhamnose monohydrate
Cat. No. :YN482509
CAS No. :6155-35-7
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | α-L-Rhamnose monohydrate |
| CAS NO.: | 6155-35-7 |
| Chemical Name: | |
| Synonyms: | 6-deoxy-L-mannose monohydrate |
| Molecular Weight: | 182.17 |
| Molecular Formula: | C₆H₁₄O₆ |
| SMILES: | O[C@@H]([C@@H](O[C@H]1O)C)[C@H]([C@H]1O)O.O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | L-Rhamnose monohydrate is used as a starting material for the production of furanones. It is an important material involved in the reaction of flavors developed during the preparation of various foods like bread, grilled meats, etc. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
