ABMA
Cat. No. :YN250356
CAS No. :332108-65-3
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | ABMA |
| CAS NO.: | 332108-65-3 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 350.29 |
| Molecular Formula: | C₁₈H₂₄BrNO |
| SMILES: | COC1=CC=C(Br)C=C1CNC2(C3)CC4CC3CC(C4)C2 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | ABMA is a broad-spectrum inhibitor of intracellular toxins and pathogens. ABMA efficiently protects cells against various toxins and pathogens includingviruses,intracellular bacteria and parasite. ABMA selectively acts at host cell late endosomes rather than targeting toxin or pathogen itself. ABMA has broad-spectrum anti-infection activity. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
