Terconazole
Cat. No. :YN251358
CAS No. :67915-31-5
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Terconazole |
| CAS NO.: | 67915-31-5 |
| Chemical Name: | |
| Synonyms: | Terazol 3, Terazol 7, Triaconazole, Gyno-Terazol |
| Molecular Weight: | 532.46 |
| Molecular Formula: | C₂₆H₃₁Cl₂N₅O₃ |
| SMILES: | CC(N1CCN(C2=CC=C(OC[C@@H]3O[C@@](CN4N=CN=C4)(C5=CC=C(Cl)C=C5Cl)OC3)C=C2)CC1)C |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Terconazole is a new, broad-spectrum, triazole antifungal agent which is primarily used to treat vaginal fungal infections. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
