BTZ043 Racemate
Cat. No. :YN250499
CAS No. :957217-65-1
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | BTZ043 Racemate |
| CAS NO.: | 957217-65-1 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 431.39 |
| Molecular Formula: | C₁₇H₁₆F₃N₃O₅S |
| SMILES: | O=C1N=C(N(CC2)CCC32OCC(C)O3)SC4=C([N+]([O-])=O)C=C(C(F)(F)F)C=C14 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | BTZ043 racemate is a decaprenylphosphoryl-β-D-ribose 2'-epimerase (DprE1) inhibitor acting as a new antimycobacterial agent that kill Mycobacterium tuberculosis. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
