3,3'-Di-O-methylellagic acid
Cat. No. :YN482735
CAS No. :2239-88-5
Pack size
price
inventory
5mg
$ 686.00
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | 3,3'-Di-O-methylellagic acid |
| CAS NO.: | 2239-88-5 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 330.25 |
| Molecular Formula: | C₁₆H₁₀O₈ |
| SMILES: | O=C1C2=CC(O)=C(OC)C(O3)=C2C4=C(C3=O)C=C(O)C(OC)=C4O1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | 3,3'-Di-O-methylellagic acid obtained fromEuphorbia adenochloraselectively inhibits the formation of acid-fastness in mycobacteria without retardation of their growth. 3,3'-di-O-methylellagic acid as a hepatoprotective compound is apparently due to its antioxidative effect. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
