Amphotericin B methyl ester
Cat. No. :YN250487
CAS No. :36148-89-7
Pack size
price
inventory
100mg
$ 730.00
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Amphotericin B methyl ester |
| CAS NO.: | 36148-89-7 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 938.11 |
| Molecular Formula: | C₄₈H₇₅NO₁₇ |
| SMILES: | COC([C@H]1[C@@]2([H])O[C@](O)(C[C@H](C[C@H]([C@@H](CC[C@H](C[C@H](CC(O[C@H]([C@@H]([C@H](O)[C@@H](C)/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](O[C@@]3([H])[C@H]([C@H]([C@H](O)[C@@H](C)O3)N)O)C2)C)C)=O)O)O)O)O)O)C[C@@H]1O)=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Amphotericin B methyl ester is the methyl ester derivative of the polyene antibiotic Amphotericin B (A634250). Amphotericin B methyl ester is the cholesterol-binding compound possesses significant antifungal activity. Amphotericin B methyl ester disrupts HIV-1 particle production and potently inhibits HIV-1 replication. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
