3'-Azido-3'-deoxy-5-fluorocytidine
Cat. No. :YN290111
CAS No. :2095417-18-6
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | 3'-Azido-3'-deoxy-5-fluorocytidine |
| CAS NO.: | 2095417-18-6 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 286.22 |
| Molecular Formula: | C₉H₁₁FN₆O₄ |
| SMILES: | O=C1N([C@@H]2O[C@H](CO)[C@@H](N=[N+]=[N-])[C@H]2O)C=C(F)C(N)=N1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | 3'-Azido-3'-deoxy-5-fluorocytidine (Compound 12) is a cytidine derivative. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
