2’-O,4’-C-Methyleneuridine
Cat. No. :YN290110
CAS No. :200435-92-3
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | 2’-O,4’-C-Methyleneuridine |
| CAS NO.: | 200435-92-3 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 256.21 |
| Molecular Formula: | C₁₀H₁₂N₂O₆ |
| SMILES: | OC[C@@]12O[C@@H](N3C(NC(C=C3)=O)=O)[C@H](OC2)[C@@H]1O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | 2’-O,4’-C-Methyleneuridine (Compound 15a) is a bicyclic nucleoside. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
