Verbascoside
Cat. No. :YN251433
CAS No. :61276-17-3
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Verbascoside |
| CAS NO.: | 61276-17-3 |
| Chemical Name: | |
| Synonyms: | Acteoside, Kusaginin |
| Molecular Weight: | 624.59 |
| Molecular Formula: | C₂₉H₃₆O₁₅ |
| SMILES: | O[C@@H]([C@H](OCCC1=CC(O)=C(O)C=C1)O2)[C@H]([C@@H]([C@H]2CO)OC(/C=C/C3=CC(O)=C(O)C=C3)=O)O[C@@](O[C@@H](C)[C@H](O)[C@H]4O)([H])[C@@H]4O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Verbascoside, a phenylpropanoid glycoside from lemon verbena, has several biological properties such as anti-inflammatory, antimicrobial, antitumor, and antioxidant. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
