Diphenhydramine hydrochloride
Cat. No. :YN321447
CAS No. :147-24-0
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Diphenhydramine hydrochloride |
| CAS NO.: | 147-24-0 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 291.82 |
| Molecular Formula: | C₁₇H₂₂ClNO |
| SMILES: | CN(C)CCOC(C1=CC=CC=C1)C2=CC=CC=C2.Cl |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Diphenhydramine HCl is a first-generation histamine H1 receptor antagonist, used in various allergic conditions such as rhinitis, urticaria and conjunctivitis. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
