Pimecrolimus
Cat. No. :YN481349
CAS No. :137071-32-0
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Pimecrolimus |
| CAS NO.: | 137071-32-0 |
| Chemical Name: | |
| Synonyms: | ASM 981 |
| Molecular Weight: | 810.45 |
| Molecular Formula: | C₄₃H₆₈ClNO₁₁ |
| SMILES: | O=C([C@@](CCCC1)([H])N1C(C([C@@]2(O)[C@H](C)C[C@H](OC)[C@@](O2)([H])[C@@H](OC)C[C@@H](C)C/C(C)=C/[C@H]3CC)=O)=O)O[C@H](/C(C)=C/[C@H]4C[C@@H](OC)[C@@H](Cl)CC4)[C@H](C)[C@@H](O)CC3=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Pimecrolimus is an immunophilin ligand, which binds specifically to the cytosolic receptor, immunophilin macrophilin-12 (FKBP-12) a calcineurin inhibitor. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
