Bromoenol lactone
Cat. No. :YN370364
CAS No. :88070-98-8
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Bromoenol lactone |
| CAS NO.: | 88070-98-8 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 317.18 |
| Molecular Formula: | C₁₆H₁₃BrO₂ |
| SMILES: | O=C1C(C2=C3C=CC=CC3=CC=C2)CC/C(O1)=CBr |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Bromoenol lactone ((6E)-Bromoenol lactone) is a suicide-based irreversible, selective, potent inhibitor ofcalcium-independent phospholipase A2(iPLA2β)with an IC50 value of approximately 7μM, which inhibits antigen-stimulated mast cell exocytosis without blocking Ca2+influx. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
