Licofelone
Cat. No. :YN330483
CAS No. :156897-06-2
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Licofelone |
| CAS NO.: | 156897-06-2 |
| Chemical Name: | |
| Synonyms: | ML3000 |
| Molecular Weight: | 379.88 |
| Molecular Formula: | C₂₃H₂₂ClNO₂ |
| SMILES: | O=C(O)CC1=C(C2=CC=C(Cl)C=C2)C(C3=CC=CC=C3)=C4N1CC(C)(C)C4 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Licofelone is a dual COX/LOX inhibitor being considered as a treatment for osteoarthritis. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
