Quercetagetin
Cat. No. :YN340279
CAS No. :90-18-6
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Quercetagetin |
| CAS NO.: | 90-18-6 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 318.24 |
| Molecular Formula: | C₁₅H₁₀O₈ |
| SMILES: | O=C1C(O)=C(C2=CC=C(O)C(O)=C2)OC3=CC(O)=C(O)C(O)=C13 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Quercetagetin (6-Hydroxyquercetin) is the major flavonoid isolated fromCitrus unshiu(C. unshiu) peel. Quercetagetin is a moderately potent and selective, cell-permeablepim-1kinase inhibitor (IC50, 0.34μM). Anti-inflammatory and anticancer properties. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
