Echinocystic acid
Cat. No. :YN330534
CAS No. :510-30-5
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Echinocystic acid |
| CAS NO.: | 510-30-5 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 472.70 |
| Molecular Formula: | C₃₀H₄₈O₄ |
| SMILES: | CC1(C)CC[C@]2(C(O)=O)[C@H](O)C[C@@]3(C)[C@]4(C)CC[C@@]5([H])C(C)(C)[C@@H](O)CC[C@]5(C)[C@@]4([H])CC=C3[C@]2([H])C1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Echinocystic acid (EA), a natural triterpone enriched in various herbs, displays a range of pharmacological activities including anti-inflammatory and antioxidant effects. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
