DSP Crosslinker
Cat. No. :YN260046
CAS No. :57757-57-0
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | DSP Crosslinker |
| CAS NO.: | 57757-57-0 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 404.42 |
| Molecular Formula: | C₁₄H₁₆N₂O₈S₂ |
| SMILES: | O=C(CCSSCCC(ON1C(CCC1=O)=O)=O)ON2C(CCC2=O)=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | DSP Crosslinker is a cleavableADC linker, used in the synthesis of antibody-drug conjugates (ADCs). |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
