Pterosin B
Cat. No. :YN330610
CAS No. :34175-96-7
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Pterosin B |
| CAS NO.: | 34175-96-7 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 218.29 |
| Molecular Formula: | C₁₄H₁₈O₂ |
| SMILES: | O=C1[C@H](C)CC2=C1C(C)=C(CCO)C(C)=C2 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Pterosin B, a indanone found in bracken fern (Pteridium aquilinum), is an inhibitor ofsalt-inducible kinase 3 (Sik3)signaling. Pterosin B prevents chondrocyte hypertrophy and osteoarthritis in mice by inhibiting Sik3. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
