Ibuprofen piconol
Cat. No. :YN480126
CAS No. :64622-45-3
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Ibuprofen piconol |
| CAS NO.: | 64622-45-3 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 297.39 |
| Molecular Formula: | C₁₉H₂₃NO₂ |
| SMILES: | O=C(OCC1=NC=CC=C1)C(C)C2=CC=C(CC(C)C)C=C2 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Ibuprofen is a nonsteroidal anti-inflammatory agent (NSAIA) or nonsteroidal anti-inflammatory drug (NSAID), with analgesic and antipyretic properties. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
