Tyk2-IN-9
Cat. No. :YN340108
CAS No. :2127109-85-5
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Tyk2-IN-9 |
| CAS NO.: | 2127109-85-5 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 383.41 |
| Molecular Formula: | C₂₀H₁₇N₉ |
| SMILES: | N#CC[C@@]1(N2N=CC(C3=NC(C4=CN(C)N=C4)=CN5C3=CC=N5)=C2)C[C@H](C#N)C1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Tyk2-IN-9 is a potent,selective and specific inhibitor ofJAK kinases, inhibits Tyk2, JAK1 and JAK2 with IC50 values of 6nM, 21nM and 6nM, respectively. Tyk2-IN-9, example 19, is extracted from patent US2017240552A1. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.