NSC-60339
Cat. No. :YN250276
CAS No. :70-09-7
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | NSC-60339 |
| CAS NO.: | 70-09-7 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 486.95 |
| Molecular Formula: | C₂₆H₂₃ClN₆O₂ |
| SMILES: | O=C(C1=CC=C(C=C1Cl)C(NC2=CC=C(C=C2)C3=NCCN3)=O)NC4=CC=C(C=C4)C5=NCCN5 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | NSC-60339, anefflux pumpinhibitor and a substrate of AcrAB-TolC, is a polybasic terephthalic acid derivative studied as a potential cancer chemotherapeutic agent. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
