Brazilin
Cat. No. :YN270440
CAS No. :474-07-7
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Brazilin |
| CAS NO.: | 474-07-7 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 286.28 |
| Molecular Formula: | C₁₆H₁₄O₅ |
| SMILES: | OC1=CC=C([C@]2([H])[C@](CC3=C2C=C(O)C(O)=C3)(O)CO4)C4=C1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | A flavonoid with diverse bioactivities; inhibits Aβ (1-42) fibrillogenesis (IC50 = 1.5 µM); prevents Aβ (1-42) mature fibril remodeling; inhibits the production of cytokines, including PGE2 and TNF-α (IC50s = 12.6 and 87.2 µM); effective against Gram-posi |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
