NO-prednisolone
Cat. No. :YN330043
CAS No. :327610-87-7
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | NO-prednisolone |
| CAS NO.: | 327610-87-7 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 539.57 |
| Molecular Formula: | C₂₉H₃₃NO₉ |
| SMILES: | C[C@@]12[C@](C(COC(C3=CC=C(CO[N+]([O-])=O)C=C3)=O)=O)(O)CC[C@@]1([H])[C@]4([H])CCC5=CC(C=C[C@]5(C)[C@@]4([H])[C@@H](O)C2)=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | NO-prednisolone is a nitric oxide (NO)-releasing derivative of Prednisolone. NO-prednisolone potently stimulatesIL-10production in vivo. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
