Flumethasone
Cat. No. :YN481950
CAS No. :2135-17-3
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Flumethasone |
| CAS NO.: | 2135-17-3 |
| Chemical Name: | |
| Synonyms: | RS-2177, NSC-54702 |
| Molecular Weight: | 410.45 |
| Molecular Formula: | C₂₂H₂₈F₂O₅ |
| SMILES: | C[C@@]12[C@](C(CO)=O)(O)[C@H](C)C[C@@]1([H])[C@]3([H])C[C@H](F)C4=CC(C=C[C@]4(C)[C@@]3(F)[C@@H](O)C2)=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Flumethasone is a glucocorticoid receptor agonist, this complex binds to the nucleus causing a variety of genetic activation and repressions. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
