Dehydroevodiamine
Cat. No. :YN330618
CAS No. :67909-49-3
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Dehydroevodiamine |
| CAS NO.: | 67909-49-3 |
| Chemical Name: | |
| Synonyms: | DHED |
| Molecular Weight: | 301.34 |
| Molecular Formula: | C₁₉H₁₅N₃O |
| SMILES: | O=C1N2C(C([N-]C3=C4C=CC=C3)=C4CC2)=[N+](C)C5=C1C=CC=C5 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Dehydroevodiamine, a constituent of Evodia rutaecarpa, has various biological effects such as hypotensive, negative chronotropic, ion channel depressant, inhibition of nitric oxide production and cerebral blood flow enhancing activities. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
