N-Glycolylneuraminic acid
Cat. No. :YN250421
CAS No. :1113-83-3
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | N-Glycolylneuraminic acid |
| CAS NO.: | 1113-83-3 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 325.27 |
| Molecular Formula: | C₁₁H₁₉NO₁₀ |
| SMILES: | O[C@@]1(O[C@H]([C@@H]([C@H](C1)O)NC(CO)=O)[C@@H]([C@@H](CO)O)O)C(O)=O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | N-Glycolylneuraminic acid is a nonhuman sialic acid molecule synthesized in pigs but not in humans. N-Glycolylneuraminic acid works as a decoy receptor of N-Glycolylneuraminic acid-bindinginfluenza A viruses (IAVs). |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
