Ketohexokinase inhibitor 1
Cat. No. :YN484289
CAS No. :2102501-84-6
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | Ketohexokinase inhibitor 1 |
| CAS NO.: | 2102501-84-6 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 356.34 |
| Molecular Formula: | C₁₆H₁₉F₃N₄O₂ |
| SMILES: | O=C(C[C@H]1[C@@]2(CN(C[C@]12[H])C3=NC(N4[C@H](CC4)C)=NC(C(F)(F)F)=C3)[H])O |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | Ketohexokinase inhibitor 1 is an inhibitor ofketohexokinase (KHK), with IC50s of 8.4nM and 66nM for KHK-C and KHK-A, respectively, extracted from patent US 20170183328 A1, example 4. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
