DPM-1001
Cat. No. :YN370924
CAS No. :1471172-27-6
86-020-82000279
sales@ubiochem.com
order@ubiochem.com| Product Name: | DPM-1001 |
| CAS NO.: | 1471172-27-6 |
| Chemical Name: | |
| Synonyms: | |
| Molecular Weight: | 567.85 |
| Molecular Formula: | C₃₅H₅₇N₃O₃ |
| SMILES: | O[C@H]1[C@]2([H])[C@@](CC[C@@]3(C)[C@@]2([H])CC[C@]3([H])[C@H](C)CCC(OC)=O)([H])[C@]4(C)[C@@](C[C@H](NCCCCNCC5=CC=CC=N5)CC4)([H])C1 |
| Storage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Transportation: | Room temperature in continental US; may vary elsewhere. |
| Description: | DPM-1001 is a potent, specific, orally bioavailable and non-competitive inhibitor ofprotein-tyrosine phosphatase (PTP1B)with an IC50 of 100nM, an an analog of the specific PTP1B inhibitor trodusquemine (MSI-1436; IC50=600nM). DPM-1001 has anti-diabetic property. |
| IC50&Target: | |
| In Vitro: | |
| In Vivo: | |
| Clinical Trial: | |
| Solvent & Solubility: | |
| References: |
TELL : +86-020-82000279
Add:Room 519, Block F, Guangzhou International Business Incubator, No.3 Lanyue Road, Science Town, Huangpu District, Guangzhou, China.
